C20H35O4- — CID 139036273
(11Z,13E,15S)-15-hydroperoxyicosa-11,13-dienoate (PubChem CID 139036273) has the molecular formula C20H35O4- and a molecular weight of 339.50 g/mol. Its IUPAC name is (11Z,13E,15S)-15-hydroperoxyicosa-11,13-dienoate.
| Compound Name | (11Z,13E,15S)-15-hydroperoxyicosa-11,13-dienoate |
|---|---|
| PubChem CID | 139036273 |
| Molecular Formula | C20H35O4- |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | (11Z,13E,15S)-15-hydroperoxyicosa-11,13-dienoate |
| SMILES | CCCCC[C@@H](/C=C/C=C\CCCCCCCCCC(=O)[O-])OO |
| InChI | InChI=1S/C20H36O4/c1-2-3-13-16-19(24-23)17-14-11-9-7-5-4-6-8-10-12-15-18-20(21)22/h9,11,14,17,19,23H,2-8,10,12-13,15-16,18H2,1H3,(H,21,22)/p-1/b11-9-,17-14+/t19-/m0/s1 |
| InChIKey | KEXNVBSLXJLOPR-XMSPSUPSSA-M |
| XLogP | 4.80 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|