About 2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine
2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine (PubChem CID 139036713) has the molecular formula C14H10N2O4
and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine.
Molecular Properties
| Compound Name | 2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine |
| PubChem CID | 139036713 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine |
| SMILES | O=c1c([O-])c(O)c1=O.c1cc(-c2cc[nH+]cc2)ccn1 |
| InChI | InChI=1S/C10H8N2.C4H2O4/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;5-1-2(6)4(8)3(1)7/h1-8H;5-6H |
| InChIKey | VEIABDKVUHXBKW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine?
The IUPAC name of 2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine (CID 139036713) is 2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine.
What is the SMILES notation for 2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine?
The canonical SMILES for 2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine is O=c1c([O-])c(O)c1=O.c1cc(-c2cc[nH+]cc2)ccn1.
What is the InChIKey of 2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine?
The InChIKey is VEIABDKVUHXBKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C4H2O4/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;5-1-2(6)4(8)3(1)7/h1-8H;5-6H.
What are the key properties of 2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine?
2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine has a molecular weight of 270.24 g/mol, XLogP of -0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,4-dioxocyclobuten-1-olate;4-pyridin-1-ium-4-ylpyridine is sourced from PubChem (CID 139036713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).