C21H27NO7 — CID 139037292
ethyl (1S,2R,5R,6R,8S,9R)-8-benzoyloxy-3,11,11-trimethyl-4,10,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-5-carboxylate (PubChem CID 139037292) has the molecular formula C21H27NO7 and a molecular weight of 405.45 g/mol. Its IUPAC name is ethyl (1S,2R,5R,6R,8S,9R)-8-benzoyloxy-3,11,11-trimethyl-4,10,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-5-carboxylate.
| Compound Name | ethyl (1S,2R,5R,6R,8S,9R)-8-benzoyloxy-3,11,11-trimethyl-4,10,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-5-carboxylate |
|---|---|
| PubChem CID | 139037292 |
| Molecular Formula | C21H27NO7 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | ethyl (1S,2R,5R,6R,8S,9R)-8-benzoyloxy-3,11,11-trimethyl-4,10,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1ON(C)[C@@H]2[C@H]1C[C@H](OC(=O)c1ccccc1)[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C21H27NO7/c1-5-25-20(24)16-13-11-14(26-19(23)12-9-7-6-8-10-12)17-18(15(13)22(4)29-16)28-21(2,3)27-17/h6-10,13-18H,5,11H2,1-4H3/t13-,14+,15-,16-,17-,18+/m1/s1 |
| InChIKey | FBEHMJNFWCLAMG-HVKXIDHRSA-N |
| XLogP | 1.93 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |