C36H28N4S2 — CID 139037455
3-methyl-2,6-diphenylimidazo[2,1-b][1,3]thiazole (PubChem CID 139037455) has the molecular formula C36H28N4S2 and a molecular weight of 580.78 g/mol. Its IUPAC name is 3-methyl-2,6-diphenylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 3-methyl-2,6-diphenylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 139037455 |
| Molecular Formula | C36H28N4S2 |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | 3-methyl-2,6-diphenylimidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1c(-c2ccccc2)sc2nc(-c3ccccc3)cn12.Cc1c(-c2ccccc2)sc2nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/2C18H14N2S/c2*1-13-17(15-10-6-3-7-11-15)21-18-19-16(12-20(13)18)14-8-4-2-5-9-14/h2*2-12H,1H3 |
| InChIKey | YOYXXXVRGXERSE-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |