C27H26BN3O — CID 139037550
N,N-dimethyl-4-(9-methyl-2,2-diphenyl-3-oxa-8-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-4-yl)aniline (PubChem CID 139037550) has the molecular formula C27H26BN3O and a molecular weight of 419.34 g/mol. Its IUPAC name is N,N-dimethyl-4-(9-methyl-2,2-diphenyl-3-oxa-8-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-4-yl)aniline.
| Compound Name | N,N-dimethyl-4-(9-methyl-2,2-diphenyl-3-oxa-8-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-4-yl)aniline |
|---|---|
| PubChem CID | 139037550 |
| Molecular Formula | C27H26BN3O |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N,N-dimethyl-4-(9-methyl-2,2-diphenyl-3-oxa-8-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-4-yl)aniline |
| SMILES | Cc1c[n+]2c(cn1)C=C(c1ccc(N(C)C)cc1)O[B-]2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26BN3O/c1-21-20-31-26(19-29-21)18-27(22-14-16-25(17-15-22)30(2)3)32-28(31,23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-20H,1-3H3 |
| InChIKey | WRCPDIVZIKYGOM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|