C18H31NO2 — CID 139037658
(5R,7S,7aS,11aS)-5-hexyl-7-hydroxy-1,2,5,6,7,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-one (PubChem CID 139037658) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is (5R,7S,7aS,11aS)-5-hexyl-7-hydroxy-1,2,5,6,7,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-one.
| Compound Name | (5R,7S,7aS,11aS)-5-hexyl-7-hydroxy-1,2,5,6,7,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-one |
|---|---|
| PubChem CID | 139037658 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | (5R,7S,7aS,11aS)-5-hexyl-7-hydroxy-1,2,5,6,7,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-3-one |
| SMILES | CCCCCC[C@@H]1C[C@H](O)[C@H]2CCCC[C@]23CCC(=O)N13 |
| InChI | InChI=1S/C18H31NO2/c1-2-3-4-5-8-14-13-16(20)15-9-6-7-11-18(15)12-10-17(21)19(14)18/h14-16,20H,2-13H2,1H3/t14-,15-,16+,18+/m1/s1 |
| InChIKey | UFVPUHRBCUPQEL-CBZIJGRNSA-N |
| XLogP | 3.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|