C21H40O3Si — CID 139037991
(2S,3R,6R)-2-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-methylbut-2-enyl]-6-methyl-3-propan-2-ylcyclohexan-1-one (PubChem CID 139037991) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is (2S,3R,6R)-2-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-methylbut-2-enyl]-6-methyl-3-propan-2-ylcyclohexan-1-one.
| Compound Name | (2S,3R,6R)-2-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-methylbut-2-enyl]-6-methyl-3-propan-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 139037991 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (2S,3R,6R)-2-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-2-methylbut-2-enyl]-6-methyl-3-propan-2-ylcyclohexan-1-one |
| SMILES | C/C(=C\CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)[C@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C21H40O3Si/c1-14(2)17-11-10-15(3)19(23)18(17)20(16(4)12-13-22)24-25(8,9)21(5,6)7/h12,14-15,17-18,20,22H,10-11,13H2,1-9H3/b16-12+/t15-,17-,18-,20+/m1/s1 |
| InChIKey | LDTAEOMGAQMQNU-WQANQSPXSA-N |
| XLogP | 5.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|