C38H46N2O2 — CID 139038051
tert-butyl (3R,4S)-3-[benzyl(propan-2-yl)amino]-4-(dibenzylamino)-4-phenylbutanoate (PubChem CID 139038051) has the molecular formula C38H46N2O2 and a molecular weight of 562.80 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-[benzyl(propan-2-yl)amino]-4-(dibenzylamino)-4-phenylbutanoate.
| Compound Name | tert-butyl (3R,4S)-3-[benzyl(propan-2-yl)amino]-4-(dibenzylamino)-4-phenylbutanoate |
|---|---|
| PubChem CID | 139038051 |
| Molecular Formula | C38H46N2O2 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.36 |
| IUPAC Name | tert-butyl (3R,4S)-3-[benzyl(propan-2-yl)amino]-4-(dibenzylamino)-4-phenylbutanoate |
| SMILES | CC(C)N(Cc1ccccc1)[C@H](CC(=O)OC(C)(C)C)[C@H](c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C38H46N2O2/c1-30(2)40(29-33-22-14-8-15-23-33)35(26-36(41)42-38(3,4)5)37(34-24-16-9-17-25-34)39(27-31-18-10-6-11-19-31)28-32-20-12-7-13-21-32/h6-25,30,35,37H,26-29H2,1-5H3/t35-,37+/m1/s1 |
| InChIKey | IGDPZJLWIIZAOC-BZFILIQBSA-N |
| XLogP | 8.44 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |