C24H34O4 — CID 139038103
(1R,3R,6R,10S,12S,13E)-19-methoxy-3,4,10,12,14-pentamethyl-18-oxatricyclo[14.2.1.01,6]nonadeca-4,13,16(19)-triene-15,17-dione (PubChem CID 139038103) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is (1R,3R,6R,10S,12S,13E)-19-methoxy-3,4,10,12,14-pentamethyl-18-oxatricyclo[14.2.1.01,6]nonadeca-4,13,16(19)-triene-15,17-dione.
| Compound Name | (1R,3R,6R,10S,12S,13E)-19-methoxy-3,4,10,12,14-pentamethyl-18-oxatricyclo[14.2.1.01,6]nonadeca-4,13,16(19)-triene-15,17-dione |
|---|---|
| PubChem CID | 139038103 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (1R,3R,6R,10S,12S,13E)-19-methoxy-3,4,10,12,14-pentamethyl-18-oxatricyclo[14.2.1.01,6]nonadeca-4,13,16(19)-triene-15,17-dione |
| SMILES | COC1=C2C(=O)O[C@@]13C[C@@H](C)C(C)=C[C@H]3CCC[C@H](C)C[C@H](C)/C=C(\C)C2=O |
| InChI | InChI=1S/C24H34O4/c1-14-8-7-9-19-12-16(3)18(5)13-24(19)22(27-6)20(23(26)28-24)21(25)17(4)11-15(2)10-14/h11-12,14-15,18-19H,7-10,13H2,1-6H3/b17-11+/t14-,15-,18+,19+,24+/m0/s1 |
| InChIKey | PNAPFVVZRWOJCW-NSNSBYTDSA-N |
| XLogP | 5.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|