C18H21BrO5 — CID 139038200
ethyl (3aS,5S,6R,6aS)-6-(4-bromophenyl)-3a-hydroxy-3,3-dimethyl-1-oxo-4,5,6,6a-tetrahydrocyclopenta[c]furan-5-carboxylate (PubChem CID 139038200) has the molecular formula C18H21BrO5 and a molecular weight of 397.27 g/mol. Its IUPAC name is ethyl (3aS,5S,6R,6aS)-6-(4-bromophenyl)-3a-hydroxy-3,3-dimethyl-1-oxo-4,5,6,6a-tetrahydrocyclopenta[c]furan-5-carboxylate.
| Compound Name | ethyl (3aS,5S,6R,6aS)-6-(4-bromophenyl)-3a-hydroxy-3,3-dimethyl-1-oxo-4,5,6,6a-tetrahydrocyclopenta[c]furan-5-carboxylate |
|---|---|
| PubChem CID | 139038200 |
| Molecular Formula | C18H21BrO5 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | ethyl (3aS,5S,6R,6aS)-6-(4-bromophenyl)-3a-hydroxy-3,3-dimethyl-1-oxo-4,5,6,6a-tetrahydrocyclopenta[c]furan-5-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@]2(O)[C@@H](C(=O)OC2(C)C)[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H21BrO5/c1-4-23-15(20)12-9-18(22)14(16(21)24-17(18,2)3)13(12)10-5-7-11(19)8-6-10/h5-8,12-14,22H,4,9H2,1-3H3/t12-,13+,14+,18-/m0/s1 |
| InChIKey | AKDZEBZLDXHRIQ-LWGWVAHUSA-N |
| XLogP | 2.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |