C27H35BF2N2 — CID 139038267
8-(4-tert-butylphenyl)-5,11-diethyl-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139038267) has the molecular formula C27H35BF2N2 and a molecular weight of 436.40 g/mol. Its IUPAC name is 8-(4-tert-butylphenyl)-5,11-diethyl-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 8-(4-tert-butylphenyl)-5,11-diethyl-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139038267 |
| Molecular Formula | C27H35BF2N2 |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | 8-(4-tert-butylphenyl)-5,11-diethyl-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CCC1=C(C)C2=C(c3ccc(C(C)(C)C)cc3)c3c(C)c(CC)c(C)n3[B-](F)(F)[N+]2=C1C |
| InChI | InChI=1S/C27H35BF2N2/c1-10-22-16(3)25-24(20-12-14-21(15-13-20)27(7,8)9)26-17(4)23(11-2)19(6)32(26)28(29,30)31(25)18(22)5/h12-15H,10-11H2,1-9H3 |
| InChIKey | VMYICDIFJFJZPW-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|