C21H14BI2NO — CID 139038555
2,2-bis(4-iodophenyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene (PubChem CID 139038555) has the molecular formula C21H14BI2NO and a molecular weight of 560.97 g/mol. Its IUPAC name is 2,2-bis(4-iodophenyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene.
| Compound Name | 2,2-bis(4-iodophenyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
|---|---|
| PubChem CID | 139038555 |
| Molecular Formula | C21H14BI2NO |
| Molecular Weight | 560.97 g/mol |
| Exact Mass | 560.93 |
| IUPAC Name | 2,2-bis(4-iodophenyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
| SMILES | Ic1ccc([B-]2(c3ccc(I)cc3)Oc3cccc4ccc[n+]2c34)cc1 |
| InChI | InChI=1S/C21H14BI2NO/c23-18-10-6-16(7-11-18)22(17-8-12-19(24)13-9-17)25-14-2-4-15-3-1-5-20(26-22)21(15)25/h1-14H |
| InChIKey | OOLQMXXIMDVQNX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.97 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|