C28H48B4O8 — CID 139038606
4,4,5,5-tetramethyl-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]-1,3,2-dioxaborolane (PubChem CID 139038606) has the molecular formula C28H48B4O8 and a molecular weight of 555.93 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 139038606 |
| Molecular Formula | C28H48B4O8 |
| Molecular Weight | 555.93 g/mol |
| Exact Mass | 556.37 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C#CB2OC(C)(C)C(C)(C)O2)OC1(C)C.CC1(C)OB(C#CB2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/2C14H24B2O4/c2*1-11(2)12(3,4)18-15(17-11)9-10-16-19-13(5,6)14(7,8)20-16/h2*1-8H3 |
| InChIKey | WJHYVNMMTFCHQO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.93 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|