C43H37F3NO4P — CID 139038738
[(1S,2R)-2-[benzyl(diphenylphosphoryl)amino]-1,2-diphenylethyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 139038738) has the molecular formula C43H37F3NO4P and a molecular weight of 719.74 g/mol. Its IUPAC name is [(1S,2R)-2-[benzyl(diphenylphosphoryl)amino]-1,2-diphenylethyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S,2R)-2-[benzyl(diphenylphosphoryl)amino]-1,2-diphenylethyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 139038738 |
| Molecular Formula | C43H37F3NO4P |
| Molecular Weight | 719.74 g/mol |
| Exact Mass | 719.24 |
| IUPAC Name | [(1S,2R)-2-[benzyl(diphenylphosphoryl)amino]-1,2-diphenylethyl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CO[C@@](C(=O)O[C@@H](c1ccccc1)[C@@H](c1ccccc1)N(Cc1ccccc1)P(=O)(c1ccccc1)c1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C43H37F3NO4P/c1-50-42(43(44,45)46,36-26-14-5-15-27-36)41(48)51-40(35-24-12-4-13-25-35)39(34-22-10-3-11-23-34)47(32-33-20-8-2-9-21-33)52(49,37-28-16-6-17-29-37)38-30-18-7-19-31-38/h2-31,39-40H,32H2,1H3/t39-,40+,42-/m1/s1 |
| InChIKey | WUJRUEHVCPWFPN-JOVQOBAQSA-N |
| XLogP | 9.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.74 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|