C13H18ClNO — CID 139038828
(9R,9aS)-9-methyl-5,6,7,8,9a,10-hexahydropyrido[1,2-a]indol-5-ium-9-ol chloride (PubChem CID 139038828) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is (9R,9aS)-9-methyl-5,6,7,8,9a,10-hexahydropyrido[1,2-a]indol-5-ium-9-ol chloride.
| Compound Name | (9R,9aS)-9-methyl-5,6,7,8,9a,10-hexahydropyrido[1,2-a]indol-5-ium-9-ol chloride |
|---|---|
| PubChem CID | 139038828 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (9R,9aS)-9-methyl-5,6,7,8,9a,10-hexahydropyrido[1,2-a]indol-5-ium-9-ol chloride |
| SMILES | C[C@@]1(O)CCC[NH+]2c3ccccc3C[C@H]21.[Cl-] |
| InChI | InChI=1S/C13H17NO.ClH/c1-13(15)7-4-8-14-11-6-3-2-5-10(11)9-12(13)14;/h2-3,5-6,12,15H,4,7-9H2,1H3;1H/t12-,13+;/m0./s1 |
| InChIKey | OWBNYIFGOSCFTC-JHEYCYPBSA-N |
| XLogP | -2.32 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |