About 3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine
3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine (PubChem CID 139038967) has the molecular formula C19H15N3O
and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine.
Molecular Properties
| Compound Name | 3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine |
| PubChem CID | 139038967 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine |
| SMILES | C(=C/c1ccncc1)\c1ccncc1.N#Cc1cccc(O)c1 |
| InChI | InChI=1S/C12H10N2.C7H5NO/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;8-5-6-2-1-3-7(9)4-6/h1-10H;1-4,9H/b2-1+; |
| InChIKey | CXTSMFLBLCXCHU-TYYBGVCCSA-N |
| XLogP | 3.91 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The IUPAC name of 3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine (CID 139038967) is 3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine.
What is the SMILES notation for 3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The canonical SMILES for 3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine is C(=C/c1ccncc1)\c1ccncc1.N#Cc1cccc(O)c1.
What is the InChIKey of 3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The InChIKey is CXTSMFLBLCXCHU-TYYBGVCCSA-N. The full InChI is InChI=1S/C12H10N2.C7H5NO/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;8-5-6-2-1-3-7(9)4-6/h1-10H;1-4,9H/b2-1+;.
What are the key properties of 3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine?
3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine has a molecular weight of 301.35 g/mol, XLogP of 3.91, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxybenzonitrile;4-[(E)-2-pyridin-4-ylethenyl]pyridine is sourced from PubChem (CID 139038967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).