About bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine
bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine (PubChem CID 139038973) has the molecular formula C24H18N4O2
and a molecular weight of 394.43 g/mol. Its IUPAC name is bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine |
| PubChem CID | 139038973 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine |
| SMILES | N#Cc1ccc(O)cc1.N#Cc1ccc(O)cc1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.2C7H5NO/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*8-5-6-1-3-7(9)4-2-6/h1-8H;2*1-4,9H |
| InChIKey | TUIRZVGYRHMCJX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 113.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine?
The IUPAC name of bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine (CID 139038973) is bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine.
What is the SMILES notation for bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine?
The canonical SMILES for bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine is N#Cc1ccc(O)cc1.N#Cc1ccc(O)cc1.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine?
The InChIKey is TUIRZVGYRHMCJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2C7H5NO/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*8-5-6-1-3-7(9)4-2-6/h1-8H;2*1-4,9H.
What are the key properties of bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine?
bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine has a molecular weight of 394.43 g/mol, XLogP of 4.67, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-hydroxybenzonitrile);4-pyridin-4-ylpyridine is sourced from PubChem (CID 139038973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).