C18H23NO3 — CID 139039033
(2S,6R)-15,16-dimethoxy-10-azatetracyclo[11.4.0.02,6.06,10]heptadeca-1(17),13,15-trien-4-one (PubChem CID 139039033) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is (2S,6R)-15,16-dimethoxy-10-azatetracyclo[11.4.0.02,6.06,10]heptadeca-1(17),13,15-trien-4-one.
| Compound Name | (2S,6R)-15,16-dimethoxy-10-azatetracyclo[11.4.0.02,6.06,10]heptadeca-1(17),13,15-trien-4-one |
|---|---|
| PubChem CID | 139039033 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (2S,6R)-15,16-dimethoxy-10-azatetracyclo[11.4.0.02,6.06,10]heptadeca-1(17),13,15-trien-4-one |
| SMILES | COc1cc2c(cc1OC)[C@@H]1CC(=O)C[C@]13CCCN3CC2 |
| InChI | InChI=1S/C18H23NO3/c1-21-16-8-12-4-7-19-6-3-5-18(19)11-13(20)9-15(18)14(12)10-17(16)22-2/h8,10,15H,3-7,9,11H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | XYNNJQFXZZAHHZ-MAUKXSAKSA-N |
| XLogP | 2.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |