About (6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one
(6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one (PubChem CID 139039100) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is (6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one.
Molecular Properties
| Compound Name | (6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one |
| PubChem CID | 139039100 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one |
| SMILES | O=C1CCC[C@H](C[C@@H](O)CCO)N1 |
| InChI | InChI=1S/C9H17NO3/c11-5-4-8(12)6-7-2-1-3-9(13)10-7/h7-8,11-12H,1-6H2,(H,10,13)/t7-,8+/m1/s1 |
| InChIKey | IMZQMBJRMDMNLE-SFYZADRCSA-N |
| XLogP | -0.21 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one?
The IUPAC name of (6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one (CID 139039100) is (6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one.
What is the SMILES notation for (6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one?
The canonical SMILES for (6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one is O=C1CCC[C@H](C[C@@H](O)CCO)N1.
What is the InChIKey of (6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one?
The InChIKey is IMZQMBJRMDMNLE-SFYZADRCSA-N. The full InChI is InChI=1S/C9H17NO3/c11-5-4-8(12)6-7-2-1-3-9(13)10-7/h7-8,11-12H,1-6H2,(H,10,13)/t7-,8+/m1/s1.
What are the key properties of (6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one?
(6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one has a molecular weight of 187.24 g/mol, XLogP of -0.21, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-[(2R)-2,4-dihydroxybutyl]piperidin-2-one is sourced from PubChem (CID 139039100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).