C15H20BrClN2O2 — CID 139039166
1-[(3aR,6S,7aS)-6-(2-bromophenyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-1H-[1,2]oxazolo[4,3-c]pyridin-1-ium-5-yl]ethanone chloride (PubChem CID 139039166) has the molecular formula C15H20BrClN2O2 and a molecular weight of 375.69 g/mol. Its IUPAC name is 1-[(3aR,6S,7aS)-6-(2-bromophenyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-1H-[1,2]oxazolo[4,3-c]pyridin-1-ium-5-yl]ethanone chloride.
| Compound Name | 1-[(3aR,6S,7aS)-6-(2-bromophenyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-1H-[1,2]oxazolo[4,3-c]pyridin-1-ium-5-yl]ethanone chloride |
|---|---|
| PubChem CID | 139039166 |
| Molecular Formula | C15H20BrClN2O2 |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 1-[(3aR,6S,7aS)-6-(2-bromophenyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-1H-[1,2]oxazolo[4,3-c]pyridin-1-ium-5-yl]ethanone chloride |
| SMILES | CC(=O)N1C[C@H]2CO[NH+](C)[C@H]2C[C@H]1c1ccccc1Br.[Cl-] |
| InChI | InChI=1S/C15H19BrN2O2.ClH/c1-10(19)18-8-11-9-20-17(2)14(11)7-15(18)12-5-3-4-6-13(12)16;/h3-6,11,14-15H,7-9H2,1-2H3;1H/t11-,14-,15-;/m0./s1 |
| InChIKey | UJKCNLDEQSBSBI-XERWJBQOSA-N |
| XLogP | -1.81 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |