About (1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide
(1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide (PubChem CID 139039308) has the molecular formula C15H24OS2
and a molecular weight of 284.49 g/mol. Its IUPAC name is (1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide.
Molecular Properties
| Compound Name | (1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide |
| PubChem CID | 139039308 |
| Molecular Formula | C15H24OS2 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide |
| SMILES | CC(C)(C)[C@@]1(C23CC4CC(CC(C4)C2)C3)S[S@]1=O |
| InChI | InChI=1S/C15H24OS2/c1-13(2,3)15(17-18(15)16)14-7-10-4-11(8-14)6-12(5-10)9-14/h10-12H,4-9H2,1-3H3/t10?,11?,12?,14?,15-,18-/m1/s1 |
| InChIKey | YVNGEFHYCAALND-OVAIDEQGSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide?
The IUPAC name of (1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide (CID 139039308) is (1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide.
What is the SMILES notation for (1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide?
The canonical SMILES for (1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide is CC(C)(C)[C@@]1(C23CC4CC(CC(C4)C2)C3)S[S@]1=O.
What is the InChIKey of (1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide?
The InChIKey is YVNGEFHYCAALND-OVAIDEQGSA-N. The full InChI is InChI=1S/C15H24OS2/c1-13(2,3)15(17-18(15)16)14-7-10-4-11(8-14)6-12(5-10)9-14/h10-12H,4-9H2,1-3H3/t10?,11?,12?,14?,15-,18-/m1/s1.
What are the key properties of (1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide?
(1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide has a molecular weight of 284.49 g/mol, XLogP of 4.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,3R)-3-(1-adamantyl)-3-tert-butyldithiirane 1-oxide is sourced from PubChem (CID 139039308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).