C15H30O3Si — CID 139039343
(1R,2S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-3-(hydroxymethyl)-5-methylcyclopentan-1-ol (PubChem CID 139039343) has the molecular formula C15H30O3Si and a molecular weight of 286.49 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-3-(hydroxymethyl)-5-methylcyclopentan-1-ol.
| Compound Name | (1R,2S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-3-(hydroxymethyl)-5-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 139039343 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (1R,2S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-3-(hydroxymethyl)-5-methylcyclopentan-1-ol |
| SMILES | C=C[C@H]1[C@H](O)[C@@H](C)C[C@@]1(CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O3Si/c1-8-12-13(17)11(2)9-15(12,10-16)18-19(6,7)14(3,4)5/h8,11-13,16-17H,1,9-10H2,2-7H3/t11-,12-,13+,15-/m0/s1 |
| InChIKey | ZRHFDXRYBLVBQR-XPCVCDNBSA-N |
| XLogP | 2.94 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|