C18H29NOSi — CID 139039380
(3S,4R,5S)-4-[dimethyl(2-phenylpropan-2-yl)silyl]-3,4,5-trimethylpyrrolidin-2-one (PubChem CID 139039380) has the molecular formula C18H29NOSi and a molecular weight of 303.52 g/mol. Its IUPAC name is (3S,4R,5S)-4-[dimethyl(2-phenylpropan-2-yl)silyl]-3,4,5-trimethylpyrrolidin-2-one.
| Compound Name | (3S,4R,5S)-4-[dimethyl(2-phenylpropan-2-yl)silyl]-3,4,5-trimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 139039380 |
| Molecular Formula | C18H29NOSi |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (3S,4R,5S)-4-[dimethyl(2-phenylpropan-2-yl)silyl]-3,4,5-trimethylpyrrolidin-2-one |
| SMILES | C[C@@H]1NC(=O)[C@H](C)[C@@]1(C)[Si](C)(C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H29NOSi/c1-13-16(20)19-14(2)18(13,5)21(6,7)17(3,4)15-11-9-8-10-12-15/h8-14H,1-7H3,(H,19,20)/t13-,14-,18+/m0/s1 |
| InChIKey | VNBNKMGIAFVEBG-SUNYJGFJSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|