C20H32O3Si — CID 139039412
(1S,4R,8S,10S,11R,14S)-10-[tert-butyl(dimethyl)silyl]oxytetracyclo[6.5.1.04,14.011,14]tetradecane-3,7-dione (PubChem CID 139039412) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is (1S,4R,8S,10S,11R,14S)-10-[tert-butyl(dimethyl)silyl]oxytetracyclo[6.5.1.04,14.011,14]tetradecane-3,7-dione.
| Compound Name | (1S,4R,8S,10S,11R,14S)-10-[tert-butyl(dimethyl)silyl]oxytetracyclo[6.5.1.04,14.011,14]tetradecane-3,7-dione |
|---|---|
| PubChem CID | 139039412 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (1S,4R,8S,10S,11R,14S)-10-[tert-butyl(dimethyl)silyl]oxytetracyclo[6.5.1.04,14.011,14]tetradecane-3,7-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H]2C(=O)CC[C@H]3C(=O)C[C@@H]4CC[C@@H]1[C@]423 |
| InChI | InChI=1S/C20H32O3Si/c1-19(2,3)24(4,5)23-18-11-15-16(21)9-8-13-17(22)10-12-6-7-14(18)20(12,13)15/h12-15,18H,6-11H2,1-5H3/t12-,13-,14-,15+,18-,20+/m0/s1 |
| InChIKey | DITGWSZFGOUAOH-LYEDSXFASA-N |
| XLogP | 4.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|