C30H32F6N4O6S2 — CID 139039420
4-[1-[2-[4-[4-(dimethylamino)phenyl]pyridin-1-ium-1-yl]ethyl]pyridin-1-ium-4-yl]-N,N-dimethylaniline;bis(trifluoromethanesulfonate) (PubChem CID 139039420) has the molecular formula C30H32F6N4O6S2 and a molecular weight of 722.73 g/mol. Its IUPAC name is 4-[1-[2-[4-[4-(dimethylamino)phenyl]pyridin-1-ium-1-yl]ethyl]pyridin-1-ium-4-yl]-N,N-dimethylaniline;bis(trifluoromethanesulfonate).
| Compound Name | 4-[1-[2-[4-[4-(dimethylamino)phenyl]pyridin-1-ium-1-yl]ethyl]pyridin-1-ium-4-yl]-N,N-dimethylaniline;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 139039420 |
| Molecular Formula | C30H32F6N4O6S2 |
| Molecular Weight | 722.73 g/mol |
| Exact Mass | 722.17 |
| IUPAC Name | 4-[1-[2-[4-[4-(dimethylamino)phenyl]pyridin-1-ium-1-yl]ethyl]pyridin-1-ium-4-yl]-N,N-dimethylaniline;bis(trifluoromethanesulfonate) |
| SMILES | CN(C)c1ccc(-c2cc[n+](CC[n+]3ccc(-c4ccc(N(C)C)cc4)cc3)cc2)cc1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C28H32N4.2CHF3O3S/c1-29(2)27-9-5-23(6-10-27)25-13-17-31(18-14-25)21-22-32-19-15-26(16-20-32)24-7-11-28(12-8-24)30(3)4;2*2-1(3,4)8(5,6)7/h5-20H,21-22H2,1-4H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | RGZDAMBKKOJGKZ-UHFFFAOYSA-L |
| XLogP | 4.53 |
| TPSA | 128.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.73 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|