C28H26FNO2 — CID 139039432
ethyl (2R)-1-benzhydryl-2-(4-fluorophenyl)-5-methyl-2H-pyridine-3-carboxylate (PubChem CID 139039432) has the molecular formula C28H26FNO2 and a molecular weight of 427.52 g/mol. Its IUPAC name is ethyl (2R)-1-benzhydryl-2-(4-fluorophenyl)-5-methyl-2H-pyridine-3-carboxylate.
| Compound Name | ethyl (2R)-1-benzhydryl-2-(4-fluorophenyl)-5-methyl-2H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139039432 |
| Molecular Formula | C28H26FNO2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | ethyl (2R)-1-benzhydryl-2-(4-fluorophenyl)-5-methyl-2H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=CC(C)=CN(C(c2ccccc2)c2ccccc2)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C28H26FNO2/c1-3-32-28(31)25-18-20(2)19-30(27(25)23-14-16-24(29)17-15-23)26(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-19,26-27H,3H2,1-2H3/t27-/m1/s1 |
| InChIKey | GCLYNKJNZRGBOC-HHHXNRCGSA-N |
| XLogP | 6.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |