C17H21F3O6 — CID 139039540
[(1S)-2,2,2-trifluoro-1-[(3S)-2-oxooxan-3-yl]ethyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 139039540) has the molecular formula C17H21F3O6 and a molecular weight of 378.34 g/mol. Its IUPAC name is [(1S)-2,2,2-trifluoro-1-[(3S)-2-oxooxan-3-yl]ethyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [(1S)-2,2,2-trifluoro-1-[(3S)-2-oxooxan-3-yl]ethyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 139039540 |
| Molecular Formula | C17H21F3O6 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | [(1S)-2,2,2-trifluoro-1-[(3S)-2-oxooxan-3-yl]ethyl] (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)[C@@]2(C)CC[C@]1(C(=O)O[C@@H]([C@@H]1CCCOC1=O)C(F)(F)F)OC2=O |
| InChI | InChI=1S/C17H21F3O6/c1-14(2)15(3)6-7-16(14,26-12(15)22)13(23)25-10(17(18,19)20)9-5-4-8-24-11(9)21/h9-10H,4-8H2,1-3H3/t9-,10-,15-,16+/m0/s1 |
| InChIKey | TTYFTIKDSXZURB-VUKUWZNJSA-N |
| XLogP | 2.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|