About lithium;N-propylpropan-1-amine;trifluoromethanesulfonate
lithium;N-propylpropan-1-amine;trifluoromethanesulfonate (PubChem CID 139039585) has the molecular formula C7H15F3LiNO3S
and a molecular weight of 257.20 g/mol. Its IUPAC name is lithium;N-propylpropan-1-amine;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | lithium;N-propylpropan-1-amine;trifluoromethanesulfonate |
| PubChem CID | 139039585 |
| Molecular Formula | C7H15F3LiNO3S |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | lithium;N-propylpropan-1-amine;trifluoromethanesulfonate |
| SMILES | CCCNCCC.O=S(=O)([O-])C(F)(F)F.[Li+] |
| InChI | InChI=1S/C6H15N.CHF3O3S.Li/c1-3-5-7-6-4-2;2-1(3,4)8(5,6)7;/h7H,3-6H2,1-2H3;(H,5,6,7);/q;;+1/p-1 |
| InChIKey | PPHHNUNPMCGTLH-UHFFFAOYSA-M |
| XLogP | -1.55 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze lithium;N-propylpropan-1-amine;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;N-propylpropan-1-amine;trifluoromethanesulfonate?
The IUPAC name of lithium;N-propylpropan-1-amine;trifluoromethanesulfonate (CID 139039585) is lithium;N-propylpropan-1-amine;trifluoromethanesulfonate.
What is the SMILES notation for lithium;N-propylpropan-1-amine;trifluoromethanesulfonate?
The canonical SMILES for lithium;N-propylpropan-1-amine;trifluoromethanesulfonate is CCCNCCC.O=S(=O)([O-])C(F)(F)F.[Li+].
What is the InChIKey of lithium;N-propylpropan-1-amine;trifluoromethanesulfonate?
The InChIKey is PPHHNUNPMCGTLH-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15N.CHF3O3S.Li/c1-3-5-7-6-4-2;2-1(3,4)8(5,6)7;/h7H,3-6H2,1-2H3;(H,5,6,7);/q;;+1/p-1.
What are the key properties of lithium;N-propylpropan-1-amine;trifluoromethanesulfonate?
lithium;N-propylpropan-1-amine;trifluoromethanesulfonate has a molecular weight of 257.20 g/mol, XLogP of -1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;N-propylpropan-1-amine;trifluoromethanesulfonate is sourced from PubChem (CID 139039585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).