C18H24O4S — CID 139039678
ethyl (1S,2R)-2-(4-methylphenyl)sulfonylspiro[2.5]octane-1-carboxylate (PubChem CID 139039678) has the molecular formula C18H24O4S and a molecular weight of 336.45 g/mol. Its IUPAC name is ethyl (1S,2R)-2-(4-methylphenyl)sulfonylspiro[2.5]octane-1-carboxylate.
| Compound Name | ethyl (1S,2R)-2-(4-methylphenyl)sulfonylspiro[2.5]octane-1-carboxylate |
|---|---|
| PubChem CID | 139039678 |
| Molecular Formula | C18H24O4S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | ethyl (1S,2R)-2-(4-methylphenyl)sulfonylspiro[2.5]octane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](S(=O)(=O)c2ccc(C)cc2)C12CCCCC2 |
| InChI | InChI=1S/C18H24O4S/c1-3-22-17(19)15-16(18(15)11-5-4-6-12-18)23(20,21)14-9-7-13(2)8-10-14/h7-10,15-16H,3-6,11-12H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | SOOHQUSPACFCQW-HZPDHXFCSA-N |
| XLogP | 3.28 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |