C10H12O4 — CID 139039739
(3aS,5aS,8aR,8bR)-1,3a,4,5,5a,8,8a,8b-octahydrofuro[3,2-e][1]benzofuran-2,7-dione (PubChem CID 139039739) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (3aS,5aS,8aR,8bR)-1,3a,4,5,5a,8,8a,8b-octahydrofuro[3,2-e][1]benzofuran-2,7-dione.
| Compound Name | (3aS,5aS,8aR,8bR)-1,3a,4,5,5a,8,8a,8b-octahydrofuro[3,2-e][1]benzofuran-2,7-dione |
|---|---|
| PubChem CID | 139039739 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3aS,5aS,8aR,8bR)-1,3a,4,5,5a,8,8a,8b-octahydrofuro[3,2-e][1]benzofuran-2,7-dione |
| SMILES | O=C1C[C@@H]2[C@H]3CC(=O)O[C@H]3CC[C@@H]2O1 |
| InChI | InChI=1S/C10H12O4/c11-9-3-5-6-4-10(12)14-8(6)2-1-7(5)13-9/h5-8H,1-4H2/t5-,6-,7+,8+/m1/s1 |
| InChIKey | DEMNEDKOYYNESD-NGJRWZKOSA-N |
| XLogP | 0.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |