C58H44N4O6 — CID 139039804
(E)-3-[3-[(E)-3-oxo-3-pyridin-2-ylprop-1-enyl]-5-phenylmethoxyphenyl]-1-pyridin-2-ylprop-2-en-1-one (PubChem CID 139039804) has the molecular formula C58H44N4O6 and a molecular weight of 893.01 g/mol. Its IUPAC name is (E)-3-[3-[(E)-3-oxo-3-pyridin-2-ylprop-1-enyl]-5-phenylmethoxyphenyl]-1-pyridin-2-ylprop-2-en-1-one.
| Compound Name | (E)-3-[3-[(E)-3-oxo-3-pyridin-2-ylprop-1-enyl]-5-phenylmethoxyphenyl]-1-pyridin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 139039804 |
| Molecular Formula | C58H44N4O6 |
| Molecular Weight | 893.01 g/mol |
| Exact Mass | 892.33 |
| IUPAC Name | (E)-3-[3-[(E)-3-oxo-3-pyridin-2-ylprop-1-enyl]-5-phenylmethoxyphenyl]-1-pyridin-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(/C=C/C(=O)c2ccccn2)cc(OCc2ccccc2)c1)c1ccccn1.O=C(/C=C/c1cc(/C=C/C(=O)c2ccccn2)cc(OCc2ccccc2)c1)c1ccccn1 |
| InChI | InChI=1S/2C29H22N2O3/c2*32-28(26-10-4-6-16-30-26)14-12-23-18-24(13-15-29(33)27-11-5-7-17-31-27)20-25(19-23)34-21-22-8-2-1-3-9-22/h2*1-20H,21H2/b2*14-12+,15-13+ |
| InChIKey | BWCBBNFTLFFTRC-ZQUVHGGOSA-N |
| XLogP | 11.70 |
| TPSA | 138.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.01 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|