C22H39NO2Si2 — CID 139039806
[(E,3R)-3-phenyl-1,3-bis(trimethylsilyl)prop-1-enyl] N,N-di(propan-2-yl)carbamate (PubChem CID 139039806) has the molecular formula C22H39NO2Si2 and a molecular weight of 405.73 g/mol. Its IUPAC name is [(E,3R)-3-phenyl-1,3-bis(trimethylsilyl)prop-1-enyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(E,3R)-3-phenyl-1,3-bis(trimethylsilyl)prop-1-enyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 139039806 |
| Molecular Formula | C22H39NO2Si2 |
| Molecular Weight | 405.73 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | [(E,3R)-3-phenyl-1,3-bis(trimethylsilyl)prop-1-enyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)O/C(=C\[C@H](c1ccccc1)[Si](C)(C)C)[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C22H39NO2Si2/c1-17(2)23(18(3)4)22(24)25-21(27(8,9)10)16-20(26(5,6)7)19-14-12-11-13-15-19/h11-18,20H,1-10H3/b21-16+/t20-/m1/s1 |
| InChIKey | CTZJEGMPETWIBT-DXAMHKDYSA-N |
| XLogP | 6.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.73 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|