C34H36Cl4O8 — CID 139040001
bis(dichloromethane);1,4,5,8,9,12,13,16-octamethoxytetraphenylene (PubChem CID 139040001) has the molecular formula C34H36Cl4O8 and a molecular weight of 714.47 g/mol. Its IUPAC name is bis(dichloromethane);1,4,5,8,9,12,13,16-octamethoxytetraphenylene.
| Compound Name | bis(dichloromethane);1,4,5,8,9,12,13,16-octamethoxytetraphenylene |
|---|---|
| PubChem CID | 139040001 |
| Molecular Formula | C34H36Cl4O8 |
| Molecular Weight | 714.47 g/mol |
| Exact Mass | 712.12 |
| IUPAC Name | bis(dichloromethane);1,4,5,8,9,12,13,16-octamethoxytetraphenylene |
| SMILES | COc1ccc(OC)c2c1-c1c(OC)ccc(OC)c1-c1c(OC)ccc(OC)c1-c1c(OC)ccc(OC)c1-2.ClCCl.ClCCl |
| InChI | InChI=1S/C32H32O8.2CH2Cl2/c1-33-17-9-10-18(34-2)26-25(17)27-19(35-3)11-12-20(36-4)29(27)31-23(39-7)15-16-24(40-8)32(31)30-22(38-6)14-13-21(37-5)28(26)30;2*2-1-3/h9-16H,1-8H3;2*1H2/b27-25-,28-26-,31-29-,32-30-;; |
| InChIKey | KQDJGKOTSWSOPT-IWJNXKDFSA-N |
| XLogP | 9.58 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.47 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|