C66H56F12S4 — CID 139040025
3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-[4-[(E,3S)-3-methylpent-1-enyl]phenyl]thiophen-3-yl]cyclopenten-1-yl]-2-methyl-5-phenylthiophene (PubChem CID 139040025) has the molecular formula C66H56F12S4 and a molecular weight of 1205.42 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-[4-[(E,3S)-3-methylpent-1-enyl]phenyl]thiophen-3-yl]cyclopenten-1-yl]-2-methyl-5-phenylthiophene.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-[4-[(E,3S)-3-methylpent-1-enyl]phenyl]thiophen-3-yl]cyclopenten-1-yl]-2-methyl-5-phenylthiophene |
|---|---|
| PubChem CID | 139040025 |
| Molecular Formula | C66H56F12S4 |
| Molecular Weight | 1205.42 g/mol |
| Exact Mass | 1204.31 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-5-[4-[(E,3S)-3-methylpent-1-enyl]phenyl]thiophen-3-yl]cyclopenten-1-yl]-2-methyl-5-phenylthiophene |
| SMILES | CC[C@H](C)/C=C/c1ccc(-c2cc(C3=C(c4cc(-c5ccccc5)sc4C)C(F)(F)C(F)(F)C3(F)F)c(C)s2)cc1.CC[C@H](C)/C=C/c1ccc(-c2cc(C3=C(c4cc(-c5ccccc5)sc4C)C(F)(F)C(F)(F)C3(F)F)c(C)s2)cc1 |
| InChI | InChI=1S/2C33H28F6S2/c2*1-5-19(2)11-12-22-13-15-24(16-14-22)28-18-26(21(4)41-28)30-29(31(34,35)33(38,39)32(30,36)37)25-17-27(40-20(25)3)23-9-7-6-8-10-23/h2*6-19H,5H2,1-4H3/b2*12-11+/t2*19-/m00/s1 |
| InChIKey | XCLJFIDIWRMZPX-PUKXZGGNSA-N |
| XLogP | 23.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1205.42 |
| LogP ≤ 5 | 23.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|