About 4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine
4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine (PubChem CID 139040109) has the molecular formula C18H17ClN2O2
and a molecular weight of 328.80 g/mol. Its IUPAC name is 4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine.
Molecular Properties
| Compound Name | 4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine |
| PubChem CID | 139040109 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine |
| SMILES | Oc1ccc(Cl)c(O)c1.c1cc(CCc2ccncc2)ccn1 |
| InChI | InChI=1S/C12H12N2.C6H5ClO2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;7-5-2-1-4(8)3-6(5)9/h3-10H,1-2H2;1-3,8-9H |
| InChIKey | JOMZRKOVGMVSNV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine?
The IUPAC name of 4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine (CID 139040109) is 4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine.
What is the SMILES notation for 4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine?
The canonical SMILES for 4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine is Oc1ccc(Cl)c(O)c1.c1cc(CCc2ccncc2)ccn1.
What is the InChIKey of 4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine?
The InChIKey is JOMZRKOVGMVSNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.C6H5ClO2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;7-5-2-1-4(8)3-6(5)9/h3-10H,1-2H2;1-3,8-9H.
What are the key properties of 4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine?
4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine has a molecular weight of 328.80 g/mol, XLogP of 4.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobenzene-1,3-diol;4-(2-pyridin-4-ylethyl)pyridine is sourced from PubChem (CID 139040109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).