C15H10BF2NOS — CID 139040605
13,13-difluoro-11-phenyl-12-oxa-8-thia-1-azonia-13-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10-pentaene (PubChem CID 139040605) has the molecular formula C15H10BF2NOS and a molecular weight of 301.13 g/mol. Its IUPAC name is 13,13-difluoro-11-phenyl-12-oxa-8-thia-1-azonia-13-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10-pentaene.
| Compound Name | 13,13-difluoro-11-phenyl-12-oxa-8-thia-1-azonia-13-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10-pentaene |
|---|---|
| PubChem CID | 139040605 |
| Molecular Formula | C15H10BF2NOS |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 13,13-difluoro-11-phenyl-12-oxa-8-thia-1-azonia-13-boranuidatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10-pentaene |
| SMILES | F[B-]1(F)OC(c2ccccc2)=Cc2sc3ccccc3[n+]21 |
| InChI | InChI=1S/C15H10BF2NOS/c17-16(18)19-12-8-4-5-9-14(12)21-15(19)10-13(20-16)11-6-2-1-3-7-11/h1-10H |
| InChIKey | FTPRRLCYQCQNEW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|