C19H24O5S — CID 139040774
1-[(1S,3R,5S,6S,8R)-6-(benzenesulfonyl)-3-methyl-10,11-dioxatricyclo[6.2.1.01,6]undecan-5-yl]propan-2-one (PubChem CID 139040774) has the molecular formula C19H24O5S and a molecular weight of 364.46 g/mol. Its IUPAC name is 1-[(1S,3R,5S,6S,8R)-6-(benzenesulfonyl)-3-methyl-10,11-dioxatricyclo[6.2.1.01,6]undecan-5-yl]propan-2-one.
| Compound Name | 1-[(1S,3R,5S,6S,8R)-6-(benzenesulfonyl)-3-methyl-10,11-dioxatricyclo[6.2.1.01,6]undecan-5-yl]propan-2-one |
|---|---|
| PubChem CID | 139040774 |
| Molecular Formula | C19H24O5S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 1-[(1S,3R,5S,6S,8R)-6-(benzenesulfonyl)-3-methyl-10,11-dioxatricyclo[6.2.1.01,6]undecan-5-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1C[C@@H](C)C[C@@]23OC[C@@H](C[C@]12S(=O)(=O)c1ccccc1)O3 |
| InChI | InChI=1S/C19H24O5S/c1-13-8-15(9-14(2)20)18(11-16-12-23-19(18,10-13)24-16)25(21,22)17-6-4-3-5-7-17/h3-7,13,15-16H,8-12H2,1-2H3/t13-,15+,16-,18+,19+/m1/s1 |
| InChIKey | ZFNVTMHPBRMARF-AYTJEOJGSA-N |
| XLogP | 2.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |