C22H16F4N2O2 — CID 139040790
6-fluoro-2-[3,4,5-trifluoro-2-[(2-methylpropan-2-yl)oxy]-6-pyridin-2-ylphenyl]-1,3-benzoxazole (PubChem CID 139040790) has the molecular formula C22H16F4N2O2 and a molecular weight of 416.37 g/mol. Its IUPAC name is 6-fluoro-2-[3,4,5-trifluoro-2-[(2-methylpropan-2-yl)oxy]-6-pyridin-2-ylphenyl]-1,3-benzoxazole.
| Compound Name | 6-fluoro-2-[3,4,5-trifluoro-2-[(2-methylpropan-2-yl)oxy]-6-pyridin-2-ylphenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 139040790 |
| Molecular Formula | C22H16F4N2O2 |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 6-fluoro-2-[3,4,5-trifluoro-2-[(2-methylpropan-2-yl)oxy]-6-pyridin-2-ylphenyl]-1,3-benzoxazole |
| SMILES | CC(C)(C)Oc1c(F)c(F)c(F)c(-c2ccccn2)c1-c1nc2ccc(F)cc2o1 |
| InChI | InChI=1S/C22H16F4N2O2/c1-22(2,3)30-20-16(21-28-12-8-7-11(23)10-14(12)29-21)15(13-6-4-5-9-27-13)17(24)18(25)19(20)26/h4-10H,1-3H3 |
| InChIKey | XXPFJKACTGLXJT-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|