C34H36F6N2O4 — CID 139041114
(6S)-6,8,8,9-tetramethyl-4-(trifluoromethyl)-6,7-dihydropyrano[3,2-g]quinolin-2-one (PubChem CID 139041114) has the molecular formula C34H36F6N2O4 and a molecular weight of 650.66 g/mol. Its IUPAC name is (6S)-6,8,8,9-tetramethyl-4-(trifluoromethyl)-6,7-dihydropyrano[3,2-g]quinolin-2-one.
| Compound Name | (6S)-6,8,8,9-tetramethyl-4-(trifluoromethyl)-6,7-dihydropyrano[3,2-g]quinolin-2-one |
|---|---|
| PubChem CID | 139041114 |
| Molecular Formula | C34H36F6N2O4 |
| Molecular Weight | 650.66 g/mol |
| Exact Mass | 650.26 |
| IUPAC Name | (6S)-6,8,8,9-tetramethyl-4-(trifluoromethyl)-6,7-dihydropyrano[3,2-g]quinolin-2-one |
| SMILES | C[C@H]1CC(C)(C)N(C)c2cc3oc(=O)cc(C(F)(F)F)c3cc21.C[C@H]1CC(C)(C)N(C)c2cc3oc(=O)cc(C(F)(F)F)c3cc21 |
| InChI | InChI=1S/2C17H18F3NO2/c2*1-9-8-16(2,3)21(4)13-7-14-11(5-10(9)13)12(17(18,19)20)6-15(22)23-14/h2*5-7,9H,8H2,1-4H3/t2*9-/m00/s1 |
| InChIKey | KKADVYNMTDOPEK-XFNAGHOKSA-N |
| XLogP | 9.07 |
| TPSA | 66.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.66 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|