C34H40O10 — CID 139041129
(3S,5R,8Z)-12,15-dihydroxy-13-methoxy-5,9-dimethyl-4-oxatricyclo[9.4.0.03,5]pentadeca-1(11),8,12,14-tetraen-2-one (PubChem CID 139041129) has the molecular formula C34H40O10 and a molecular weight of 608.68 g/mol. Its IUPAC name is (3S,5R,8Z)-12,15-dihydroxy-13-methoxy-5,9-dimethyl-4-oxatricyclo[9.4.0.03,5]pentadeca-1(11),8,12,14-tetraen-2-one.
| Compound Name | (3S,5R,8Z)-12,15-dihydroxy-13-methoxy-5,9-dimethyl-4-oxatricyclo[9.4.0.03,5]pentadeca-1(11),8,12,14-tetraen-2-one |
|---|---|
| PubChem CID | 139041129 |
| Molecular Formula | C34H40O10 |
| Molecular Weight | 608.68 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | (3S,5R,8Z)-12,15-dihydroxy-13-methoxy-5,9-dimethyl-4-oxatricyclo[9.4.0.03,5]pentadeca-1(11),8,12,14-tetraen-2-one |
| SMILES | COc1cc(O)c2c(c1O)C/C(C)=C\CC[C@@]1(C)O[C@@H]1C2=O.COc1cc(O)c2c(c1O)C/C(C)=C\CC[C@@]1(C)O[C@@H]1C2=O |
| InChI | InChI=1S/2C17H20O5/c2*1-9-5-4-6-17(2)16(22-17)15(20)13-10(7-9)14(19)12(21-3)8-11(13)18/h2*5,8,16,18-19H,4,6-7H2,1-3H3/b2*9-5-/t2*16-,17-/m11/s1 |
| InChIKey | BUWFKXQEBIJRGN-QOSJDTPYSA-N |
| XLogP | 5.46 |
| TPSA | 158.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|