C17H27NO4 — CID 139041135
(1R,3R,9S,12R,14S)-3-hydroxy-5-methyl-5-azatetracyclo[10.4.1.01,9.09,14]heptadecane-10,16-dione;hydrate (PubChem CID 139041135) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is (1R,3R,9S,12R,14S)-3-hydroxy-5-methyl-5-azatetracyclo[10.4.1.01,9.09,14]heptadecane-10,16-dione;hydrate.
| Compound Name | (1R,3R,9S,12R,14S)-3-hydroxy-5-methyl-5-azatetracyclo[10.4.1.01,9.09,14]heptadecane-10,16-dione;hydrate |
|---|---|
| PubChem CID | 139041135 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (1R,3R,9S,12R,14S)-3-hydroxy-5-methyl-5-azatetracyclo[10.4.1.01,9.09,14]heptadecane-10,16-dione;hydrate |
| SMILES | CN1CCC[C@]23C(=O)C[C@@H]4C[C@H]2CC(=O)[C@@]3(C[C@@H](O)C1)C4.O |
| InChI | InChI=1S/C17H25NO3.H2O/c1-18-4-2-3-17-12-5-11(6-15(17)21)8-16(17,14(20)7-12)9-13(19)10-18;/h11-13,19H,2-10H2,1H3;1H2/t11-,12-,13+,16-,17+;/m0./s1 |
| InChIKey | HHEUGNWIYUHSKW-SATWDJJJSA-N |
| XLogP | 0.58 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |