About 4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine
4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine (PubChem CID 139041169) has the molecular formula C16H12Cl2N2O2
and a molecular weight of 335.19 g/mol. Its IUPAC name is 4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | 4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine |
| PubChem CID | 139041169 |
| Molecular Formula | C16H12Cl2N2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine |
| SMILES | Oc1cc(O)c(Cl)cc1Cl.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.C6H4Cl2O2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;7-3-1-4(8)6(10)2-5(3)9/h1-8H;1-2,9-10H |
| InChIKey | WLBHUVSTJHLLHG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine?
The IUPAC name of 4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine (CID 139041169) is 4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine.
What is the SMILES notation for 4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine?
The canonical SMILES for 4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine is Oc1cc(O)c(Cl)cc1Cl.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of 4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine?
The InChIKey is WLBHUVSTJHLLHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C6H4Cl2O2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;7-3-1-4(8)6(10)2-5(3)9/h1-8H;1-2,9-10H.
What are the key properties of 4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine?
4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine has a molecular weight of 335.19 g/mol, XLogP of 4.55, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichlorobenzene-1,3-diol;2-pyridin-2-ylpyridine is sourced from PubChem (CID 139041169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).