C27H22F3NO4S — CID 139041239
methyl (E)-3-[[(1S)-1,3-diphenylprop-2-ynyl]-(4-methylphenyl)sulfonylamino]-4,4,4-trifluorobut-2-enoate (PubChem CID 139041239) has the molecular formula C27H22F3NO4S and a molecular weight of 513.54 g/mol. Its IUPAC name is methyl (E)-3-[[(1S)-1,3-diphenylprop-2-ynyl]-(4-methylphenyl)sulfonylamino]-4,4,4-trifluorobut-2-enoate.
| Compound Name | methyl (E)-3-[[(1S)-1,3-diphenylprop-2-ynyl]-(4-methylphenyl)sulfonylamino]-4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 139041239 |
| Molecular Formula | C27H22F3NO4S |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | methyl (E)-3-[[(1S)-1,3-diphenylprop-2-ynyl]-(4-methylphenyl)sulfonylamino]-4,4,4-trifluorobut-2-enoate |
| SMILES | COC(=O)/C=C(/N([C@H](C#Cc1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C27H22F3NO4S/c1-20-13-16-23(17-14-20)36(33,34)31(25(27(28,29)30)19-26(32)35-2)24(22-11-7-4-8-12-22)18-15-21-9-5-3-6-10-21/h3-14,16-17,19,24H,1-2H3/b25-19+/t24-/m1/s1 |
| InChIKey | OYNUYRHKXACIHZ-BLJGPLFWSA-N |
| XLogP | 5.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|