C21H24N2O5 — CID 139041267
(4R)-3-[(1R,4R,5R)-5-(4-nitrobenzoyl)-2-bicyclo[2.2.2]oct-2-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 139041267) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is (4R)-3-[(1R,4R,5R)-5-(4-nitrobenzoyl)-2-bicyclo[2.2.2]oct-2-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(1R,4R,5R)-5-(4-nitrobenzoyl)-2-bicyclo[2.2.2]oct-2-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139041267 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (4R)-3-[(1R,4R,5R)-5-(4-nitrobenzoyl)-2-bicyclo[2.2.2]oct-2-enyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@@H]1COC(=O)N1C1=C[C@H]2CC[C@@H]1C[C@H]2C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H24N2O5/c1-12(2)19-11-28-21(25)22(19)18-10-14-3-4-15(18)9-17(14)20(24)13-5-7-16(8-6-13)23(26)27/h5-8,10,12,14-15,17,19H,3-4,9,11H2,1-2H3/t14-,15-,17-,19+/m1/s1 |
| InChIKey | XUEYWAHFFXAHNU-LFEHRJTNSA-N |
| XLogP | 4.18 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|