C18H13F3N2O4 — CID 139041380
2-[(2R,3R,4S)-2,3,4-trifluoro-4-(4-nitrophenyl)butyl]isoindole-1,3-dione (PubChem CID 139041380) has the molecular formula C18H13F3N2O4 and a molecular weight of 378.31 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-2,3,4-trifluoro-4-(4-nitrophenyl)butyl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,3R,4S)-2,3,4-trifluoro-4-(4-nitrophenyl)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139041380 |
| Molecular Formula | C18H13F3N2O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-[(2R,3R,4S)-2,3,4-trifluoro-4-(4-nitrophenyl)butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@@H](F)[C@H](F)[C@@H](F)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H13F3N2O4/c19-14(9-22-17(24)12-3-1-2-4-13(12)18(22)25)16(21)15(20)10-5-7-11(8-6-10)23(26)27/h1-8,14-16H,9H2/t14-,15+,16+/m1/s1 |
| InChIKey | XKLJBTMMFROSNR-PMPSAXMXSA-N |
| XLogP | 3.58 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|