C18H22 — CID 139041506
2,6-diethyl-4,8-dimethyl-1,6-dihydro-s-indacene (PubChem CID 139041506) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2,6-diethyl-4,8-dimethyl-1,6-dihydro-s-indacene.
| Compound Name | 2,6-diethyl-4,8-dimethyl-1,6-dihydro-s-indacene |
|---|---|
| PubChem CID | 139041506 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2,6-diethyl-4,8-dimethyl-1,6-dihydro-s-indacene |
| SMILES | CCC1=Cc2c(c(C)c3c(c2C)=CC(CC)C=3)C1 |
| InChI | InChI=1S/C18H22/c1-5-13-7-15-11(3)17-9-14(6-2)10-18(17)12(4)16(15)8-13/h7-9,13H,5-6,10H2,1-4H3 |
| InChIKey | LRIJMYZFNYIKGK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |