C34H36O8 — CID 139041662
dimethyl (1R,9S)-12-methylidenetricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate;dimethyl (1S,9R)-12-methylidenetricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate (PubChem CID 139041662) has the molecular formula C34H36O8 and a molecular weight of 572.65 g/mol. Its IUPAC name is dimethyl (1R,9S)-12-methylidenetricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate;dimethyl (1S,9R)-12-methylidenetricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate.
| Compound Name | dimethyl (1R,9S)-12-methylidenetricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate;dimethyl (1S,9R)-12-methylidenetricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate |
|---|---|
| PubChem CID | 139041662 |
| Molecular Formula | C34H36O8 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | dimethyl (1R,9S)-12-methylidenetricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate;dimethyl (1S,9R)-12-methylidenetricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11,11-dicarboxylate |
| SMILES | C=C1[C@@H]2Cc3ccccc3[C@H]1C(C(=O)OC)(C(=O)OC)C2.C=C1[C@H]2Cc3ccccc3[C@@H]1C(C(=O)OC)(C(=O)OC)C2 |
| InChI | InChI=1S/2C17H18O4/c2*1-10-12-8-11-6-4-5-7-13(11)14(10)17(9-12,15(18)20-2)16(19)21-3/h2*4-7,12,14H,1,8-9H2,2-3H3/t2*12-,14+/m10/s1 |
| InChIKey | GDFNOBBUZKXWMH-GJSFELMDSA-N |
| XLogP | 4.47 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|