About (2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate
(2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate (PubChem CID 139041702) has the molecular formula C9H12N2O7S
and a molecular weight of 292.27 g/mol. Its IUPAC name is (2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate |
| PubChem CID | 139041702 |
| Molecular Formula | C9H12N2O7S |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | (2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate |
| SMILES | NC(=O)C[NH3+].O=C(O)c1cc(S(=O)(=O)[O-])ccc1O |
| InChI | InChI=1S/C7H6O6S.C2H6N2O/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;3-1-2(4)5/h1-3,8H,(H,9,10)(H,11,12,13);1,3H2,(H2,4,5) |
| InChIKey | QFAGXKXGEXNOPK-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 185.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate?
The IUPAC name of (2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate (CID 139041702) is (2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate.
What is the SMILES notation for (2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate?
The canonical SMILES for (2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate is NC(=O)C[NH3+].O=C(O)c1cc(S(=O)(=O)[O-])ccc1O.
What is the InChIKey of (2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate?
The InChIKey is QFAGXKXGEXNOPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O6S.C2H6N2O/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;3-1-2(4)5/h1-3,8H,(H,9,10)(H,11,12,13);1,3H2,(H2,4,5).
What are the key properties of (2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate?
(2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate has a molecular weight of 292.27 g/mol, XLogP of -2.29, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl)azanium;3-carboxy-4-hydroxybenzenesulfonate is sourced from PubChem (CID 139041702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).