About 1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole
1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole (PubChem CID 139041900) has the molecular formula C26H28N2O4
and a molecular weight of 432.52 g/mol. Its IUPAC name is 1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole.
Molecular Properties
| Compound Name | 1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole |
| PubChem CID | 139041900 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole |
| SMILES | COc1cn(Cc2ccccc2)c(-c2c(OC)c(OC)cn2Cc2ccccc2)c1OC |
| InChI | InChI=1S/C26H28N2O4/c1-29-21-17-27(15-19-11-7-5-8-12-19)23(25(21)31-3)24-26(32-4)22(30-2)18-28(24)16-20-13-9-6-10-14-20/h5-14,17-18H,15-16H2,1-4H3 |
| InChIKey | NVLOXWJUEGKHMD-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole?
The IUPAC name of 1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole (CID 139041900) is 1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole.
What is the SMILES notation for 1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole?
The canonical SMILES for 1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole is COc1cn(Cc2ccccc2)c(-c2c(OC)c(OC)cn2Cc2ccccc2)c1OC.
What is the InChIKey of 1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole?
The InChIKey is NVLOXWJUEGKHMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N2O4/c1-29-21-17-27(15-19-11-7-5-8-12-19)23(25(21)31-3)24-26(32-4)22(30-2)18-28(24)16-20-13-9-6-10-14-20/h5-14,17-18H,15-16H2,1-4H3.
What are the key properties of 1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole?
1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole has a molecular weight of 432.52 g/mol, XLogP of 5.09, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-(1-benzyl-3,4-dimethoxypyrrol-2-yl)-3,4-dimethoxypyrrole is sourced from PubChem (CID 139041900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).