C18H17F3O2 — CID 139042591
(2S,4S,5R)-4,5-diphenyl-2-(trifluoromethyl)oxan-2-ol (PubChem CID 139042591) has the molecular formula C18H17F3O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is (2S,4S,5R)-4,5-diphenyl-2-(trifluoromethyl)oxan-2-ol.
| Compound Name | (2S,4S,5R)-4,5-diphenyl-2-(trifluoromethyl)oxan-2-ol |
|---|---|
| PubChem CID | 139042591 |
| Molecular Formula | C18H17F3O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (2S,4S,5R)-4,5-diphenyl-2-(trifluoromethyl)oxan-2-ol |
| SMILES | O[C@@]1(C(F)(F)F)C[C@H](c2ccccc2)[C@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C18H17F3O2/c19-18(20,21)17(22)11-15(13-7-3-1-4-8-13)16(12-23-17)14-9-5-2-6-10-14/h1-10,15-16,22H,11-12H2/t15-,16+,17+/m1/s1 |
| InChIKey | OREJRHILZKJGOP-IKGGRYGDSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |